About 2-anilinopyridin-3-ol
2-anilinopyridin-3-ol (PubChem CID 13314045) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-anilinopyridin-3-ol.
Molecular Properties
| Compound Name | 2-anilinopyridin-3-ol |
| PubChem CID | 13314045 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-anilinopyridin-3-ol |
| SMILES | Oc1cccnc1Nc1ccccc1 |
| InChI | InChI=1S/C11H10N2O/c14-10-7-4-8-12-11(10)13-9-5-2-1-3-6-9/h1-8,14H,(H,12,13) |
| InChIKey | ONVUKMIOINZASU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-anilinopyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinopyridin-3-ol?
The IUPAC name of 2-anilinopyridin-3-ol (CID 13314045) is 2-anilinopyridin-3-ol.
What is the SMILES notation for 2-anilinopyridin-3-ol?
The canonical SMILES for 2-anilinopyridin-3-ol is Oc1cccnc1Nc1ccccc1.
What is the InChIKey of 2-anilinopyridin-3-ol?
The InChIKey is ONVUKMIOINZASU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c14-10-7-4-8-12-11(10)13-9-5-2-1-3-6-9/h1-8,14H,(H,12,13).
What are the key properties of 2-anilinopyridin-3-ol?
2-anilinopyridin-3-ol has a molecular weight of 186.21 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinopyridin-3-ol is sourced from PubChem (CID 13314045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).