About N-phenylaniline;2-pyridin-2-ylpyridine
N-phenylaniline;2-pyridin-2-ylpyridine (PubChem CID 175252376) has the molecular formula C22H19N3
and a molecular weight of 325.42 g/mol. Its IUPAC name is N-phenylaniline;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | N-phenylaniline;2-pyridin-2-ylpyridine |
| PubChem CID | 175252376 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-phenylaniline;2-pyridin-2-ylpyridine |
| SMILES | c1ccc(-c2ccccn2)nc1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C10H8N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-10,13H;1-8H |
| InChIKey | JJEHWMWWNOKOQB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenylaniline;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylaniline;2-pyridin-2-ylpyridine?
The IUPAC name of N-phenylaniline;2-pyridin-2-ylpyridine (CID 175252376) is N-phenylaniline;2-pyridin-2-ylpyridine.
What is the SMILES notation for N-phenylaniline;2-pyridin-2-ylpyridine?
The canonical SMILES for N-phenylaniline;2-pyridin-2-ylpyridine is c1ccc(-c2ccccn2)nc1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of N-phenylaniline;2-pyridin-2-ylpyridine?
The InChIKey is JJEHWMWWNOKOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C10H8N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-10,13H;1-8H.
What are the key properties of N-phenylaniline;2-pyridin-2-ylpyridine?
N-phenylaniline;2-pyridin-2-ylpyridine has a molecular weight of 325.42 g/mol, XLogP of 5.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylaniline;2-pyridin-2-ylpyridine is sourced from PubChem (CID 175252376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).