C14H12N6 — CID 166773388
5-N,6-N-diphenyltetrazine-5,6-diamine (PubChem CID 166773388) has the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-N,6-N-diphenyltetrazine-5,6-diamine.
| Compound Name | 5-N,6-N-diphenyltetrazine-5,6-diamine |
|---|---|
| PubChem CID | 166773388 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-N,6-N-diphenyltetrazine-5,6-diamine |
| SMILES | c1ccc(Nc2nnnnc2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C14H12N6/c1-3-7-11(8-4-1)15-13-14(18-20-19-17-13)16-12-9-5-2-6-10-12/h1-10H,(H,15,17,20)(H,16,18,19) |
| InChIKey | RLSCUYOJBCFGDN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |