About 5-N,6-N-diphenyltetrazine-5,6-diamine
5-N,6-N-diphenyltetrazine-5,6-diamine (PubChem CID 166773388) has the molecular formula C14H12N6
and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-N,6-N-diphenyltetrazine-5,6-diamine.
Molecular Properties
| Compound Name | 5-N,6-N-diphenyltetrazine-5,6-diamine |
| PubChem CID | 166773388 |
| Molecular Formula | C14H12N6 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-N,6-N-diphenyltetrazine-5,6-diamine |
| SMILES | c1ccc(Nc2nnnnc2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C14H12N6/c1-3-7-11(8-4-1)15-13-14(18-20-19-17-13)16-12-9-5-2-6-10-12/h1-10H,(H,15,17,20)(H,16,18,19) |
| InChIKey | RLSCUYOJBCFGDN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-N,6-N-diphenyltetrazine-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N,6-N-diphenyltetrazine-5,6-diamine?
The IUPAC name of 5-N,6-N-diphenyltetrazine-5,6-diamine (CID 166773388) is 5-N,6-N-diphenyltetrazine-5,6-diamine.
What is the SMILES notation for 5-N,6-N-diphenyltetrazine-5,6-diamine?
The canonical SMILES for 5-N,6-N-diphenyltetrazine-5,6-diamine is c1ccc(Nc2nnnnc2Nc2ccccc2)cc1.
What is the InChIKey of 5-N,6-N-diphenyltetrazine-5,6-diamine?
The InChIKey is RLSCUYOJBCFGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N6/c1-3-7-11(8-4-1)15-13-14(18-20-19-17-13)16-12-9-5-2-6-10-12/h1-10H,(H,15,17,20)(H,16,18,19).
What are the key properties of 5-N,6-N-diphenyltetrazine-5,6-diamine?
5-N,6-N-diphenyltetrazine-5,6-diamine has a molecular weight of 264.29 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N,6-N-diphenyltetrazine-5,6-diamine is sourced from PubChem (CID 166773388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).