C27H26N4O — CID 152517216
2,4-bis(2-anilino-3-pyridinyl)pentan-3-one (PubChem CID 152517216) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 2,4-bis(2-anilino-3-pyridinyl)pentan-3-one.
| Compound Name | 2,4-bis(2-anilino-3-pyridinyl)pentan-3-one |
|---|---|
| PubChem CID | 152517216 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2,4-bis(2-anilino-3-pyridinyl)pentan-3-one |
| SMILES | CC(C(=O)C(C)c1cccnc1Nc1ccccc1)c1cccnc1Nc1ccccc1 |
| InChI | InChI=1S/C27H26N4O/c1-19(23-15-9-17-28-26(23)30-21-11-5-3-6-12-21)25(32)20(2)24-16-10-18-29-27(24)31-22-13-7-4-8-14-22/h3-20H,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | YGTTYJHELGYBOO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |