C22H22N2O2 — CID 155134049
2-[3-[(2-propan-2-ylphenyl)methyl]anilino]pyridine-3-carboxylic acid (PubChem CID 155134049) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[3-[(2-propan-2-ylphenyl)methyl]anilino]pyridine-3-carboxylic acid.
| Compound Name | 2-[3-[(2-propan-2-ylphenyl)methyl]anilino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155134049 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[3-[(2-propan-2-ylphenyl)methyl]anilino]pyridine-3-carboxylic acid |
| SMILES | CC(C)c1ccccc1Cc1cccc(Nc2ncccc2C(=O)O)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-15(2)19-10-4-3-8-17(19)13-16-7-5-9-18(14-16)24-21-20(22(25)26)11-6-12-23-21/h3-12,14-15H,13H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | HXNJAXWHXQPKMJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |