C26H22N4O3 — CID 118000101
(E)-3-[2-(4-hydroxyanilino)-3-pyridinyl]-1-[2-[4-(hydroxymethyl)anilino]-3-pyridinyl]prop-2-en-1-one (PubChem CID 118000101) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is (E)-3-[2-(4-hydroxyanilino)-3-pyridinyl]-1-[2-[4-(hydroxymethyl)anilino]-3-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-(4-hydroxyanilino)-3-pyridinyl]-1-[2-[4-(hydroxymethyl)anilino]-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118000101 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (E)-3-[2-(4-hydroxyanilino)-3-pyridinyl]-1-[2-[4-(hydroxymethyl)anilino]-3-pyridinyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccnc1Nc1ccc(O)cc1)c1cccnc1Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C26H22N4O3/c31-17-18-5-8-20(9-6-18)30-26-23(4-2-16-28-26)24(33)14-7-19-3-1-15-27-25(19)29-21-10-12-22(32)13-11-21/h1-16,31-32H,17H2,(H,27,29)(H,28,30)/b14-7+ |
| InChIKey | JDKUAQDOVUHLNM-VGOFMYFVSA-N |
| XLogP | 5.06 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|