C23H23N3O4 — CID 118000114
(E)-1-(4-aminophenyl)-3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]prop-2-en-1-one (PubChem CID 118000114) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (E)-1-(4-aminophenyl)-3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-aminophenyl)-3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118000114 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (E)-1-(4-aminophenyl)-3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]prop-2-en-1-one |
| SMILES | COc1cc(Nc2ncccc2/C=C/C(=O)c2ccc(N)cc2)cc(CO)c1CO |
| InChI | InChI=1S/C23H23N3O4/c1-30-22-12-19(11-17(13-27)20(22)14-28)26-23-16(3-2-10-25-23)6-9-21(29)15-4-7-18(24)8-5-15/h2-12,27-28H,13-14,24H2,1H3,(H,25,26)/b9-6+ |
| InChIKey | FAZJUQWDQUAGIU-RMKNXTFCSA-N |
| XLogP | 3.30 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|