C22H18N2O4 — CID 141346142
4-[(E)-3-(2-anilino-3-pyridinyl)-3-oxoprop-1-enyl]-3-methoxybenzoic acid (PubChem CID 141346142) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-[(E)-3-(2-anilino-3-pyridinyl)-3-oxoprop-1-enyl]-3-methoxybenzoic acid.
| Compound Name | 4-[(E)-3-(2-anilino-3-pyridinyl)-3-oxoprop-1-enyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 141346142 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[(E)-3-(2-anilino-3-pyridinyl)-3-oxoprop-1-enyl]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1/C=C/C(=O)c1cccnc1Nc1ccccc1 |
| InChI | InChI=1S/C22H18N2O4/c1-28-20-14-16(22(26)27)10-9-15(20)11-12-19(25)18-8-5-13-23-21(18)24-17-6-3-2-4-7-17/h2-14H,1H3,(H,23,24)(H,26,27)/b12-11+ |
| InChIKey | GDTWIMKGXSJYKB-VAWYXSNFSA-N |
| XLogP | 4.43 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|