C20H17N3O4 — CID 178064937
2-(5-benzamido-2-methoxyanilino)pyridine-3-carboxylic acid (PubChem CID 178064937) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-(5-benzamido-2-methoxyanilino)pyridine-3-carboxylic acid.
| Compound Name | 2-(5-benzamido-2-methoxyanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 178064937 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-(5-benzamido-2-methoxyanilino)pyridine-3-carboxylic acid |
| SMILES | COc1ccc(NC(=O)c2ccccc2)cc1Nc1ncccc1C(=O)O |
| InChI | InChI=1S/C20H17N3O4/c1-27-17-10-9-14(22-19(24)13-6-3-2-4-7-13)12-16(17)23-18-15(20(25)26)8-5-11-21-18/h2-12H,1H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | FJCJSLCTRHRFOH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |