C14H13N2O4- — CID 7130288
2-(2,5-dimethoxyanilino)pyridine-3-carboxylate (PubChem CID 7130288) has the molecular formula C14H13N2O4- and a molecular weight of 273.27 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)pyridine-3-carboxylate.
| Compound Name | 2-(2,5-dimethoxyanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7130288 |
| Molecular Formula | C14H13N2O4- |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(2,5-dimethoxyanilino)pyridine-3-carboxylate |
| SMILES | COc1ccc(OC)c(Nc2ncccc2C(=O)[O-])c1 |
| InChI | InChI=1S/C14H14N2O4/c1-19-9-5-6-12(20-2)11(8-9)16-13-10(14(17)18)4-3-7-15-13/h3-8H,1-2H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | JDVGPSXRICKZCY-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |