C15H13ClN2O2 — CID 178064932
1-[2-(5-chloro-2-methoxyanilino)-3-pyridinyl]prop-2-en-1-one (PubChem CID 178064932) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-methoxyanilino)-3-pyridinyl]prop-2-en-1-one.
| Compound Name | 1-[2-(5-chloro-2-methoxyanilino)-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 178064932 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-[2-(5-chloro-2-methoxyanilino)-3-pyridinyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1cccnc1Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H13ClN2O2/c1-3-13(19)11-5-4-8-17-15(11)18-12-9-10(16)6-7-14(12)20-2/h3-9H,1H2,2H3,(H,17,18) |
| InChIKey | LNRUWGSIJCXRMM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|