C21H15Cl2N3O4 — CID 123651664
1-[2-(2,4-dichloroanilino)-3-pyridinyl]-3-(4-methoxy-3-nitrophenyl)prop-2-en-1-one (PubChem CID 123651664) has the molecular formula C21H15Cl2N3O4 and a molecular weight of 444.27 g/mol. Its IUPAC name is 1-[2-(2,4-dichloroanilino)-3-pyridinyl]-3-(4-methoxy-3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-[2-(2,4-dichloroanilino)-3-pyridinyl]-3-(4-methoxy-3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123651664 |
| Molecular Formula | C21H15Cl2N3O4 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 1-[2-(2,4-dichloroanilino)-3-pyridinyl]-3-(4-methoxy-3-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cccnc2Nc2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15Cl2N3O4/c1-30-20-9-5-13(11-18(20)26(28)29)4-8-19(27)15-3-2-10-24-21(15)25-17-7-6-14(22)12-16(17)23/h2-12H,1H3,(H,24,25) |
| InChIKey | LJJFHOAWTIQVNX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|