C24H23N3O7 — CID 123868019
3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-1-(4-methoxy-3-nitrophenyl)prop-2-en-1-one (PubChem CID 123868019) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is 3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-1-(4-methoxy-3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-1-(4-methoxy-3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123868019 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 3-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-1-(4-methoxy-3-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cccnc2Nc2cc(CO)c(CO)c(OC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23N3O7/c1-33-22-8-6-16(11-20(22)27(31)32)21(30)7-5-15-4-3-9-25-24(15)26-18-10-17(13-28)19(14-29)23(12-18)34-2/h3-12,28-29H,13-14H2,1-2H3,(H,25,26) |
| InChIKey | FXZLHZMMGXKBKO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|