C28H26N4O4 — CID 154059881
1-(2-anilino-3-pyridinyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-en-1-one (PubChem CID 154059881) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 1-(2-anilino-3-pyridinyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-en-1-one.
| Compound Name | 1-(2-anilino-3-pyridinyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154059881 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 1-(2-anilino-3-pyridinyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-en-1-one |
| SMILES | COc1cc(Nc2ncccc2C=CC(=O)c2cccnc2Nc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C28H26N4O4/c1-34-24-17-21(18-25(35-2)26(24)36-3)32-27-19(9-7-15-29-27)13-14-23(33)22-12-8-16-30-28(22)31-20-10-5-4-6-11-20/h4-18H,1-3H3,(H,29,32)(H,30,31) |
| InChIKey | NYJLQMQEOHQYGY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|