C25H24Cl2N4O5 — CID 168818961
(E)-N-(2-acetamido-4,5-dichlorophenyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-enamide (PubChem CID 168818961) has the molecular formula C25H24Cl2N4O5 and a molecular weight of 531.40 g/mol. Its IUPAC name is (E)-N-(2-acetamido-4,5-dichlorophenyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-(2-acetamido-4,5-dichlorophenyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 168818961 |
| Molecular Formula | C25H24Cl2N4O5 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (E)-N-(2-acetamido-4,5-dichlorophenyl)-3-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]prop-2-enamide |
| SMILES | COc1cc(Nc2ncccc2/C=C/C(=O)Nc2cc(Cl)c(Cl)cc2NC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H24Cl2N4O5/c1-14(32)29-19-12-17(26)18(27)13-20(19)31-23(33)8-7-15-6-5-9-28-25(15)30-16-10-21(34-2)24(36-4)22(11-16)35-3/h5-13H,1-4H3,(H,28,30)(H,29,32)(H,31,33)/b8-7+ |
| InChIKey | CPZQNDXEUSYGEH-BQYQJAHWSA-N |
| XLogP | 5.77 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|