C24H24Cl2N4O4 — CID 168819007
(E)-N-(2-amino-4,5-dichlorophenyl)-4-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]but-2-enamide (PubChem CID 168819007) has the molecular formula C24H24Cl2N4O4 and a molecular weight of 503.39 g/mol. Its IUPAC name is (E)-N-(2-amino-4,5-dichlorophenyl)-4-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]but-2-enamide.
| Compound Name | (E)-N-(2-amino-4,5-dichlorophenyl)-4-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 168819007 |
| Molecular Formula | C24H24Cl2N4O4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | (E)-N-(2-amino-4,5-dichlorophenyl)-4-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]but-2-enamide |
| SMILES | COc1cc(Nc2ncccc2C/C=C/C(=O)Nc2cc(Cl)c(Cl)cc2N)cc(OC)c1OC |
| InChI | InChI=1S/C24H24Cl2N4O4/c1-32-20-10-15(11-21(33-2)23(20)34-3)29-24-14(7-5-9-28-24)6-4-8-22(31)30-19-13-17(26)16(25)12-18(19)27/h4-5,7-13H,6,27H2,1-3H3,(H,28,29)(H,30,31)/b8-4+ |
| InChIKey | FUDPVBUAGAHKMJ-XBXARRHUSA-N |
| XLogP | 5.48 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|