C27H37N3O6 — CID 156646078
N-(1,5-dioxohexan-2-yl)-7-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]heptanamide (PubChem CID 156646078) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is N-(1,5-dioxohexan-2-yl)-7-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]heptanamide.
| Compound Name | N-(1,5-dioxohexan-2-yl)-7-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]heptanamide |
|---|---|
| PubChem CID | 156646078 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | N-(1,5-dioxohexan-2-yl)-7-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]heptanamide |
| SMILES | COc1cc(Nc2ncccc2CCCCCCC(=O)NC(C=O)CCC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H37N3O6/c1-19(32)13-14-21(18-31)29-25(33)12-8-6-5-7-10-20-11-9-15-28-27(20)30-22-16-23(34-2)26(36-4)24(17-22)35-3/h9,11,15-18,21H,5-8,10,12-14H2,1-4H3,(H,28,30)(H,29,33) |
| InChIKey | GTYXRXDAGAZIFH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|