C20H31NO6 — CID 134398431
N-[(1R,2R)-1-hydroxy-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-7-oxooctanamide (PubChem CID 134398431) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is N-[(1R,2R)-1-hydroxy-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-7-oxooctanamide.
| Compound Name | N-[(1R,2R)-1-hydroxy-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-7-oxooctanamide |
|---|---|
| PubChem CID | 134398431 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[(1R,2R)-1-hydroxy-1-(3,4,5-trimethoxyphenyl)propan-2-yl]-7-oxooctanamide |
| SMILES | COc1cc([C@@H](O)[C@@H](C)NC(=O)CCCCCC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H31NO6/c1-13(22)9-7-6-8-10-18(23)21-14(2)19(24)15-11-16(25-3)20(27-5)17(12-15)26-4/h11-12,14,19,24H,6-10H2,1-5H3,(H,21,23)/t14-,19+/m1/s1 |
| InChIKey | SKJGHCMCJLFRJD-KUHUBIRLSA-N |
| XLogP | 2.79 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|