C28H25N5O6 — CID 123659495
1-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-3-[2-(4-nitroanilino)-3-pyridinyl]prop-2-en-1-one (PubChem CID 123659495) has the molecular formula C28H25N5O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is 1-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-3-[2-(4-nitroanilino)-3-pyridinyl]prop-2-en-1-one.
| Compound Name | 1-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-3-[2-(4-nitroanilino)-3-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123659495 |
| Molecular Formula | C28H25N5O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 1-[2-[3,4-bis(hydroxymethyl)-5-methoxyanilino]-3-pyridinyl]-3-[2-(4-nitroanilino)-3-pyridinyl]prop-2-en-1-one |
| SMILES | COc1cc(Nc2ncccc2C(=O)C=Cc2cccnc2Nc2ccc([N+](=O)[O-])cc2)cc(CO)c1CO |
| InChI | InChI=1S/C28H25N5O6/c1-39-26-15-21(14-19(16-34)24(26)17-35)32-28-23(5-3-13-30-28)25(36)11-6-18-4-2-12-29-27(18)31-20-7-9-22(10-8-20)33(37)38/h2-15,34-35H,16-17H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | PZZLBOMEGKMNIK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|