C16H17N2O3- — CID 7130496
2-(4-butoxyanilino)pyridine-3-carboxylate (PubChem CID 7130496) has the molecular formula C16H17N2O3- and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(4-butoxyanilino)pyridine-3-carboxylate.
| Compound Name | 2-(4-butoxyanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7130496 |
| Molecular Formula | C16H17N2O3- |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(4-butoxyanilino)pyridine-3-carboxylate |
| SMILES | CCCCOc1ccc(Nc2ncccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N2O3/c1-2-3-11-21-13-8-6-12(7-9-13)18-15-14(16(19)20)5-4-10-17-15/h4-10H,2-3,11H2,1H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | FYHNVXNVOIDMLC-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|