C17H24Cl2N4O2 — CID 119405364
N-(3-aminopropyl)-2-(4-ethoxyanilino)pyridine-3-carboxamide;dihydrochloride (PubChem CID 119405364) has the molecular formula C17H24Cl2N4O2 and a molecular weight of 387.31 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(4-ethoxyanilino)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-2-(4-ethoxyanilino)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119405364 |
| Molecular Formula | C17H24Cl2N4O2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(3-aminopropyl)-2-(4-ethoxyanilino)pyridine-3-carboxamide;dihydrochloride |
| SMILES | CCOc1ccc(Nc2ncccc2C(=O)NCCCN)cc1.Cl.Cl |
| InChI | InChI=1S/C17H22N4O2.2ClH/c1-2-23-14-8-6-13(7-9-14)21-16-15(5-3-11-19-16)17(22)20-12-4-10-18;;/h3,5-9,11H,2,4,10,12,18H2,1H3,(H,19,21)(H,20,22);2*1H |
| InChIKey | FDQAIFYPXRAUPX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|