2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid

C14H13FN2O4 — CID 105381770

IUPAC2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid
SMILESCOc1ccc(OC)c(Nc2nccc(C(=O)O)c2F)c1
InChIInChI=1S/C14H13FN2O4/c1-20-8-3-4-11(21-2)10(7-8)17-13-12(15)9(14(18)19)5-6-16-13/h3-7H,1-2H3,(H,16,17)(H,18,19)
InChIKeyQRHVSWYRUGJODD-UHFFFAOYSA-N
MW292.27 g/mol
LogP2.68
Rot. Bonds5

About 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid

2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid (PubChem CID 105381770) has the molecular formula C14H13FN2O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid
PubChem CID105381770
Molecular FormulaC14H13FN2O4
Molecular Weight292.27 g/mol
Exact Mass292.09
IUPAC Name2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid
SMILESCOc1ccc(OC)c(Nc2nccc(C(=O)O)c2F)c1
InChIInChI=1S/C14H13FN2O4/c1-20-8-3-4-11(21-2)10(7-8)17-13-12(15)9(14(18)19)5-6-16-13/h3-7H,1-2H3,(H,16,17)(H,18,19)
InChIKeyQRHVSWYRUGJODD-UHFFFAOYSA-N
XLogP2.68
TPSA80.68 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.27
LogP ≤ 52.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid?
The IUPAC name of 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid (CID 105381770) is 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid.
What is the SMILES notation for 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid?
The canonical SMILES for 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid is COc1ccc(OC)c(Nc2nccc(C(=O)O)c2F)c1.
What is the InChIKey of 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid?
The InChIKey is QRHVSWYRUGJODD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O4/c1-20-8-3-4-11(21-2)10(7-8)17-13-12(15)9(14(18)19)5-6-16-13/h3-7H,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid?
2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid has a molecular weight of 292.27 g/mol, XLogP of 2.68, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxyanilino)-3-fluoropyridine-4-carboxylic acid is sourced from PubChem (CID 105381770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).