C14H14N4O2 — CID 82817759
3-amino-2-(2,5-dimethoxyanilino)pyridine-4-carbonitrile (PubChem CID 82817759) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-amino-2-(2,5-dimethoxyanilino)pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-(2,5-dimethoxyanilino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 82817759 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-amino-2-(2,5-dimethoxyanilino)pyridine-4-carbonitrile |
| SMILES | COc1ccc(OC)c(Nc2nccc(C#N)c2N)c1 |
| InChI | InChI=1S/C14H14N4O2/c1-19-10-3-4-12(20-2)11(7-10)18-14-13(16)9(8-15)5-6-17-14/h3-7H,16H2,1-2H3,(H,17,18) |
| InChIKey | QFNYKVFCTOUQTC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |