C8H6F2N2O2 — CID 157041880
N-(3,5-difluoro-4-formyl-2-pyridinyl)acetamide (PubChem CID 157041880) has the molecular formula C8H6F2N2O2 and a molecular weight of 200.14 g/mol. Its IUPAC name is N-(3,5-difluoro-4-formyl-2-pyridinyl)acetamide.
| Compound Name | N-(3,5-difluoro-4-formyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 157041880 |
| Molecular Formula | C8H6F2N2O2 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | N-(3,5-difluoro-4-formyl-2-pyridinyl)acetamide |
| SMILES | CC(=O)Nc1ncc(F)c(C=O)c1F |
| InChI | InChI=1S/C8H6F2N2O2/c1-4(14)12-8-7(10)5(3-13)6(9)2-11-8/h2-3H,1H3,(H,11,12,14) |
| InChIKey | YIKSUWZGDAMIDV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|