C14H24FN3O — CID 105383012
[2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-fluoro-4-pyridinyl]methanol (PubChem CID 105383012) has the molecular formula C14H24FN3O and a molecular weight of 269.36 g/mol. Its IUPAC name is [2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-fluoro-4-pyridinyl]methanol.
| Compound Name | [2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-fluoro-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105383012 |
| Molecular Formula | C14H24FN3O |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | [2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-fluoro-4-pyridinyl]methanol |
| SMILES | CC(C)CN(CCN(C)C)c1nccc(CO)c1F |
| InChI | InChI=1S/C14H24FN3O/c1-11(2)9-18(8-7-17(3)4)14-13(15)12(10-19)5-6-16-14/h5-6,11,19H,7-10H2,1-4H3 |
| InChIKey | TWCYYEPSPDZVNH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |