C14H22ClN3O2 — CID 107062353
3-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]pyridine-4-carboxylic acid (PubChem CID 107062353) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 3-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107062353 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-chloro-2-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]pyridine-4-carboxylic acid |
| SMILES | CC(C)CN(CCN(C)C)c1nccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H22ClN3O2/c1-10(2)9-18(8-7-17(3)4)13-12(15)11(14(19)20)5-6-16-13/h5-6,10H,7-9H2,1-4H3,(H,19,20) |
| InChIKey | GSFHORONGFVSNM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |