C13H20ClN3O2 — CID 107062432
3-chloro-2-[2-(dimethylamino)ethyl-propylamino]pyridine-4-carboxylic acid (PubChem CID 107062432) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is 3-chloro-2-[2-(dimethylamino)ethyl-propylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-[2-(dimethylamino)ethyl-propylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107062432 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-chloro-2-[2-(dimethylamino)ethyl-propylamino]pyridine-4-carboxylic acid |
| SMILES | CCCN(CCN(C)C)c1nccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C13H20ClN3O2/c1-4-7-17(9-8-16(2)3)12-11(14)10(13(18)19)5-6-15-12/h5-6H,4,7-9H2,1-3H3,(H,18,19) |
| InChIKey | MXCXVFIXASSBKH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |