C12H15FN2O — CID 105383144
[3-fluoro-2-[propyl(prop-2-ynyl)amino]-4-pyridinyl]methanol (PubChem CID 105383144) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is [3-fluoro-2-[propyl(prop-2-ynyl)amino]-4-pyridinyl]methanol.
| Compound Name | [3-fluoro-2-[propyl(prop-2-ynyl)amino]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105383144 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | [3-fluoro-2-[propyl(prop-2-ynyl)amino]-4-pyridinyl]methanol |
| SMILES | C#CCN(CCC)c1nccc(CO)c1F |
| InChI | InChI=1S/C12H15FN2O/c1-3-7-15(8-4-2)12-11(13)10(9-16)5-6-14-12/h1,5-6,16H,4,7-9H2,2H3 |
| InChIKey | YXWDAGYXGBJDAO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|