C14H25N3O — CID 55008988
[6-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-pyridinyl]methanol (PubChem CID 55008988) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is [6-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-pyridinyl]methanol.
| Compound Name | [6-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 55008988 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | [6-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-3-pyridinyl]methanol |
| SMILES | CC(C)CN(CCN(C)C)c1ccc(CO)cn1 |
| InChI | InChI=1S/C14H25N3O/c1-12(2)10-17(8-7-16(3)4)14-6-5-13(11-18)9-15-14/h5-6,9,12,18H,7-8,10-11H2,1-4H3 |
| InChIKey | IUITYIQPFOZQPY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |