C15H26FN3S — CID 105386429
4-[(tert-butylamino)methyl]-3-fluoro-N-(2-methyl-3-methylsulfanylpropyl)pyridin-2-amine (PubChem CID 105386429) has the molecular formula C15H26FN3S and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-3-fluoro-N-(2-methyl-3-methylsulfanylpropyl)pyridin-2-amine.
| Compound Name | 4-[(tert-butylamino)methyl]-3-fluoro-N-(2-methyl-3-methylsulfanylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105386429 |
| Molecular Formula | C15H26FN3S |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-3-fluoro-N-(2-methyl-3-methylsulfanylpropyl)pyridin-2-amine |
| SMILES | CSCC(C)CNc1nccc(CNC(C)(C)C)c1F |
| InChI | InChI=1S/C15H26FN3S/c1-11(10-20-5)8-18-14-13(16)12(6-7-17-14)9-19-15(2,3)4/h6-7,11,19H,8-10H2,1-5H3,(H,17,18) |
| InChIKey | MJLVPYJIFJUNTI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |