C15H26FN5 — CID 105387168
N-[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]-4-methylpiperazin-1-amine (PubChem CID 105387168) has the molecular formula C15H26FN5 and a molecular weight of 295.41 g/mol. Its IUPAC name is N-[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]-4-methylpiperazin-1-amine.
| Compound Name | N-[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]-4-methylpiperazin-1-amine |
|---|---|
| PubChem CID | 105387168 |
| Molecular Formula | C15H26FN5 |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | N-[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]-4-methylpiperazin-1-amine |
| SMILES | CN1CCN(Nc2nccc(CNC(C)(C)C)c2F)CC1 |
| InChI | InChI=1S/C15H26FN5/c1-15(2,3)18-11-12-5-6-17-14(13(12)16)19-21-9-7-20(4)8-10-21/h5-6,18H,7-11H2,1-4H3,(H,17,19) |
| InChIKey | AZQKHRDALHJSRY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |