C14H21FN4O — CID 106197832
4-[[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]amino]pyrrolidin-2-one (PubChem CID 106197832) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]amino]pyrrolidin-2-one.
| Compound Name | 4-[[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106197832 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-[[4-[(tert-butylamino)methyl]-3-fluoro-2-pyridinyl]amino]pyrrolidin-2-one |
| SMILES | CC(C)(C)NCc1ccnc(NC2CNC(=O)C2)c1F |
| InChI | InChI=1S/C14H21FN4O/c1-14(2,3)18-7-9-4-5-16-13(12(9)15)19-10-6-11(20)17-8-10/h4-5,10,18H,6-8H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | XSSBTFWQEWVEIS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |