C9H12FN3 — CID 62732869
3-fluoro-N-pyrrolidin-3-ylpyridin-2-amine (PubChem CID 62732869) has the molecular formula C9H12FN3 and a molecular weight of 181.21 g/mol. Its IUPAC name is 3-fluoro-N-pyrrolidin-3-ylpyridin-2-amine.
| Compound Name | 3-fluoro-N-pyrrolidin-3-ylpyridin-2-amine |
|---|---|
| PubChem CID | 62732869 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 3-fluoro-N-pyrrolidin-3-ylpyridin-2-amine |
| SMILES | Fc1cccnc1NC1CCNC1 |
| InChI | InChI=1S/C9H12FN3/c10-8-2-1-4-12-9(8)13-7-3-5-11-6-7/h1-2,4,7,11H,3,5-6H2,(H,12,13) |
| InChIKey | SLCJCEXRTCRMAB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |