C10H15ClN4O2 — CID 71635602
3-nitro-N-[(3S)-piperidin-3-yl]pyridin-2-amine;hydrochloride (PubChem CID 71635602) has the molecular formula C10H15ClN4O2 and a molecular weight of 258.71 g/mol. Its IUPAC name is 3-nitro-N-[(3S)-piperidin-3-yl]pyridin-2-amine;hydrochloride.
| Compound Name | 3-nitro-N-[(3S)-piperidin-3-yl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71635602 |
| Molecular Formula | C10H15ClN4O2 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-nitro-N-[(3S)-piperidin-3-yl]pyridin-2-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccnc1N[C@H]1CCCNC1 |
| InChI | InChI=1S/C10H14N4O2.ClH/c15-14(16)9-4-2-6-12-10(9)13-8-3-1-5-11-7-8;/h2,4,6,8,11H,1,3,5,7H2,(H,12,13);1H/t8-;/m0./s1 |
| InChIKey | BCEDSJHWQLWCJK-QRPNPIFTSA-N |
| XLogP | 1.58 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|