C12H17FN4O2 — CID 126821677
N-[1-(2-fluoroethyl)piperidin-3-yl]-3-nitropyridin-2-amine (PubChem CID 126821677) has the molecular formula C12H17FN4O2 and a molecular weight of 268.29 g/mol. Its IUPAC name is N-[1-(2-fluoroethyl)piperidin-3-yl]-3-nitropyridin-2-amine.
| Compound Name | N-[1-(2-fluoroethyl)piperidin-3-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126821677 |
| Molecular Formula | C12H17FN4O2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-[1-(2-fluoroethyl)piperidin-3-yl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NC1CCCN(CCF)C1 |
| InChI | InChI=1S/C12H17FN4O2/c13-5-8-16-7-2-3-10(9-16)15-12-11(17(18)19)4-1-6-14-12/h1,4,6,10H,2-3,5,7-9H2,(H,14,15) |
| InChIKey | UUSAMCGPFFJRCJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|