C15H14ClFN4O2 — CID 133438863
N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-nitropyridin-2-amine (PubChem CID 133438863) has the molecular formula C15H14ClFN4O2 and a molecular weight of 336.75 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-nitropyridin-2-amine.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133438863 |
| Molecular Formula | C15H14ClFN4O2 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NC1CCN(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H14ClFN4O2/c16-12-8-11(3-4-13(12)17)20-7-5-10(9-20)19-15-14(21(22)23)2-1-6-18-15/h1-4,6,8,10H,5,7,9H2,(H,18,19) |
| InChIKey | CQGCYWJTMLORLI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|