C15H13ClF4N4 — CID 133438923
N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 133438923) has the molecular formula C15H13ClF4N4 and a molecular weight of 360.74 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 133438923 |
| Molecular Formula | C15H13ClF4N4 |
| Molecular Weight | 360.74 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Fc1ccc(N2CCC(Nc3nccc(C(F)(F)F)n3)C2)cc1Cl |
| InChI | InChI=1S/C15H13ClF4N4/c16-11-7-10(1-2-12(11)17)24-6-4-9(8-24)22-14-21-5-3-13(23-14)15(18,19)20/h1-3,5,7,9H,4,6,8H2,(H,21,22,23) |
| InChIKey | OAJOBHSRVAVLDN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |