C15H15Cl2FN4O — CID 133438936
4-chloro-5-[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-2-methylpyridazin-3-one (PubChem CID 133438936) has the molecular formula C15H15Cl2FN4O and a molecular weight of 357.22 g/mol. Its IUPAC name is 4-chloro-5-[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133438936 |
| Molecular Formula | C15H15Cl2FN4O |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 4-chloro-5-[[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]amino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NC2CCN(c3ccc(F)c(Cl)c3)C2)c(Cl)c1=O |
| InChI | InChI=1S/C15H15Cl2FN4O/c1-21-15(23)14(17)13(7-19-21)20-9-4-5-22(8-9)10-2-3-12(18)11(16)6-10/h2-3,6-7,9,20H,4-5,8H2,1H3 |
| InChIKey | BYFAPPVTKHMKNB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |