C9H13ClN4O2 — CID 71635600
3-nitro-N-[(3R)-pyrrolidin-3-yl]pyridin-2-amine;hydrochloride (PubChem CID 71635600) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is 3-nitro-N-[(3R)-pyrrolidin-3-yl]pyridin-2-amine;hydrochloride.
| Compound Name | 3-nitro-N-[(3R)-pyrrolidin-3-yl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71635600 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-nitro-N-[(3R)-pyrrolidin-3-yl]pyridin-2-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccnc1N[C@@H]1CCNC1 |
| InChI | InChI=1S/C9H12N4O2.ClH/c14-13(15)8-2-1-4-11-9(8)12-7-3-5-10-6-7;/h1-2,4,7,10H,3,5-6H2,(H,11,12);1H/t7-;/m1./s1 |
| InChIKey | RSNZMOIMXSSVJS-OGFXRTJISA-N |
| XLogP | 1.19 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|