C12H18FN3 — CID 63629585
3-fluoro-N-(2-piperidin-3-ylethyl)pyridin-2-amine (PubChem CID 63629585) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 3-fluoro-N-(2-piperidin-3-ylethyl)pyridin-2-amine.
| Compound Name | 3-fluoro-N-(2-piperidin-3-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63629585 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 3-fluoro-N-(2-piperidin-3-ylethyl)pyridin-2-amine |
| SMILES | Fc1cccnc1NCCC1CCCNC1 |
| InChI | InChI=1S/C12H18FN3/c13-11-4-2-7-15-12(11)16-8-5-10-3-1-6-14-9-10/h2,4,7,10,14H,1,3,5-6,8-9H2,(H,15,16) |
| InChIKey | ZBTTWICECHMWMJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |