C12H17N5 — CID 55247646
3-(2-piperidin-3-ylethylamino)pyrazine-2-carbonitrile (PubChem CID 55247646) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-(2-piperidin-3-ylethylamino)pyrazine-2-carbonitrile.
| Compound Name | 3-(2-piperidin-3-ylethylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 55247646 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-(2-piperidin-3-ylethylamino)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCCC1CCCNC1 |
| InChI | InChI=1S/C12H17N5/c13-8-11-12(17-7-6-15-11)16-5-3-10-2-1-4-14-9-10/h6-7,10,14H,1-5,9H2,(H,16,17) |
| InChIKey | TXUCKBORABVDML-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |