C14H20N4 — CID 133283842
3-(cyclooctylmethylamino)pyrazine-2-carbonitrile (PubChem CID 133283842) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-(cyclooctylmethylamino)pyrazine-2-carbonitrile.
| Compound Name | 3-(cyclooctylmethylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133283842 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3-(cyclooctylmethylamino)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCC1CCCCCCC1 |
| InChI | InChI=1S/C14H20N4/c15-10-13-14(17-9-8-16-13)18-11-12-6-4-2-1-3-5-7-12/h8-9,12H,1-7,11H2,(H,17,18) |
| InChIKey | REUDXSDJDBNURM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |