C16H16BrN5 — CID 133284176
3-[[1-(3-bromophenyl)pyrrolidin-3-yl]methylamino]pyrazine-2-carbonitrile (PubChem CID 133284176) has the molecular formula C16H16BrN5 and a molecular weight of 358.24 g/mol. Its IUPAC name is 3-[[1-(3-bromophenyl)pyrrolidin-3-yl]methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[[1-(3-bromophenyl)pyrrolidin-3-yl]methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284176 |
| Molecular Formula | C16H16BrN5 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-[[1-(3-bromophenyl)pyrrolidin-3-yl]methylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCC1CCN(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H16BrN5/c17-13-2-1-3-14(8-13)22-7-4-12(11-22)10-21-16-15(9-18)19-5-6-20-16/h1-3,5-6,8,12H,4,7,10-11H2,(H,20,21) |
| InChIKey | XTCNWCJITIOMCD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |