C10H12N4O — CID 66005273
3-[(3-hydroxycyclobutyl)methylamino]pyrazine-2-carbonitrile (PubChem CID 66005273) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-[(3-hydroxycyclobutyl)methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[(3-hydroxycyclobutyl)methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 66005273 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[(3-hydroxycyclobutyl)methylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCC1CC(O)C1 |
| InChI | InChI=1S/C10H12N4O/c11-5-9-10(13-2-1-12-9)14-6-7-3-8(15)4-7/h1-2,7-8,15H,3-4,6H2,(H,13,14) |
| InChIKey | CWVFPROXGWPFAM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |