C11H13N3O — CID 115487752
5-[(3-hydroxycyclobutyl)methylamino]pyridine-2-carbonitrile (PubChem CID 115487752) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-[(3-hydroxycyclobutyl)methylamino]pyridine-2-carbonitrile.
| Compound Name | 5-[(3-hydroxycyclobutyl)methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115487752 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-[(3-hydroxycyclobutyl)methylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NCC2CC(O)C2)cn1 |
| InChI | InChI=1S/C11H13N3O/c12-5-9-1-2-10(7-14-9)13-6-8-3-11(15)4-8/h1-2,7-8,11,13,15H,3-4,6H2 |
| InChIKey | JVIIOXRCDAPLCK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |