C14H14ClN3O — CID 115474076
6-chloro-2-N-(3,4-dihydro-2H-chromen-4-yl)pyridine-2,3-diamine (PubChem CID 115474076) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 6-chloro-2-N-(3,4-dihydro-2H-chromen-4-yl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-(3,4-dihydro-2H-chromen-4-yl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474076 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 6-chloro-2-N-(3,4-dihydro-2H-chromen-4-yl)pyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NC1CCOc2ccccc21 |
| InChI | InChI=1S/C14H14ClN3O/c15-13-6-5-10(16)14(18-13)17-11-7-8-19-12-4-2-1-3-9(11)12/h1-6,11H,7-8,16H2,(H,17,18) |
| InChIKey | NTDQGYATYROIOA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|