C15H12ClN3O — CID 83077158
2-chloro-6-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carbonitrile (PubChem CID 83077158) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-chloro-6-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83077158 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-chloro-6-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C15H12ClN3O/c16-14-7-10(9-17)8-15(19-14)18-12-5-6-20-13-4-2-1-3-11(12)13/h1-4,7-8,12H,5-6H2,(H,18,19) |
| InChIKey | NPCXVRZHERITHS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|