C14H13ClN2O — CID 55027626
6-chloro-N-(3,4-dihydro-2H-chromen-4-yl)pyridin-2-amine (PubChem CID 55027626) has the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dihydro-2H-chromen-4-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(3,4-dihydro-2H-chromen-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 55027626 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 6-chloro-N-(3,4-dihydro-2H-chromen-4-yl)pyridin-2-amine |
| SMILES | Clc1cccc(NC2CCOc3ccccc32)n1 |
| InChI | InChI=1S/C14H13ClN2O/c15-13-6-3-7-14(17-13)16-11-8-9-18-12-5-2-1-4-10(11)12/h1-7,11H,8-9H2,(H,16,17) |
| InChIKey | VIBAIKFJNCYYME-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|