C16H19N3O2 — CID 62365052
2-N-(3,4-dihydro-2H-chromen-4-yl)-6-ethoxypyridine-2,5-diamine (PubChem CID 62365052) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-N-(3,4-dihydro-2H-chromen-4-yl)-6-ethoxypyridine-2,5-diamine.
| Compound Name | 2-N-(3,4-dihydro-2H-chromen-4-yl)-6-ethoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 62365052 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-N-(3,4-dihydro-2H-chromen-4-yl)-6-ethoxypyridine-2,5-diamine |
| SMILES | CCOc1nc(NC2CCOc3ccccc32)ccc1N |
| InChI | InChI=1S/C16H19N3O2/c1-2-20-16-12(17)7-8-15(19-16)18-13-9-10-21-14-6-4-3-5-11(13)14/h3-8,13H,2,9-10,17H2,1H3,(H,18,19) |
| InChIKey | YXJSCTFCKVIJRW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |