C15H15FN2O — CID 62367472
1-N-(3,4-dihydro-2H-chromen-4-yl)-4-fluorobenzene-1,2-diamine (PubChem CID 62367472) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-N-(3,4-dihydro-2H-chromen-4-yl)-4-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-(3,4-dihydro-2H-chromen-4-yl)-4-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 62367472 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-N-(3,4-dihydro-2H-chromen-4-yl)-4-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)ccc1NC1CCOc2ccccc21 |
| InChI | InChI=1S/C15H15FN2O/c16-10-5-6-14(12(17)9-10)18-13-7-8-19-15-4-2-1-3-11(13)15/h1-6,9,13,18H,7-8,17H2 |
| InChIKey | KMRUFKWARRJVTP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|